About 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate
2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate (PubChem CID 167420692) has the molecular formula C17H26N4O4
and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate |
| PubChem CID | 167420692 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate |
| SMILES | CC(C)COC(=O)CCn1cc(CNC(=O)/C=C\C(=O)C(C)C)nn1 |
| InChI | InChI=1S/C17H26N4O4/c1-12(2)11-25-17(24)7-8-21-10-14(19-20-21)9-18-16(23)6-5-15(22)13(3)4/h5-6,10,12-13H,7-9,11H2,1-4H3,(H,18,23)/b6-5- |
| InChIKey | HZJLXXFMGAOTFU-WAYWQWQTSA-N |
| XLogP | 1.26 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate?
The IUPAC name of 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate (CID 167420692) is 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate.
What is the SMILES notation for 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate?
The canonical SMILES for 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate is CC(C)COC(=O)CCn1cc(CNC(=O)/C=C\C(=O)C(C)C)nn1.
What is the InChIKey of 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate?
The InChIKey is HZJLXXFMGAOTFU-WAYWQWQTSA-N. The full InChI is InChI=1S/C17H26N4O4/c1-12(2)11-25-17(24)7-8-21-10-14(19-20-21)9-18-16(23)6-5-15(22)13(3)4/h5-6,10,12-13H,7-9,11H2,1-4H3,(H,18,23)/b6-5-.
What are the key properties of 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate?
2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate has a molecular weight of 350.42 g/mol, XLogP of 1.26, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3-[4-[[[(Z)-5-methyl-4-oxohex-2-enoyl]amino]methyl]triazol-1-yl]propanoate is sourced from PubChem (CID 167420692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).