C27H19Cl2F3N6O4 — CID 167421788
4-[1-[(1S)-1-[5-[3-chloro-6-(4-chlorotriazol-1-yl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(difluoromethoxy)propyl]pyrazol-4-yl]benzoic acid (PubChem CID 167421788) has the molecular formula C27H19Cl2F3N6O4 and a molecular weight of 619.39 g/mol. Its IUPAC name is 4-[1-[(1S)-1-[5-[3-chloro-6-(4-chlorotriazol-1-yl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(difluoromethoxy)propyl]pyrazol-4-yl]benzoic acid.
| Compound Name | 4-[1-[(1S)-1-[5-[3-chloro-6-(4-chlorotriazol-1-yl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(difluoromethoxy)propyl]pyrazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 167421788 |
| Molecular Formula | C27H19Cl2F3N6O4 |
| Molecular Weight | 619.39 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | 4-[1-[(1S)-1-[5-[3-chloro-6-(4-chlorotriazol-1-yl)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(difluoromethoxy)propyl]pyrazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cnn([C@@H](CCOC(F)F)c3ccc(-c4c(-n5cc(Cl)nn5)ccc(Cl)c4F)c[n+]3[O-])c2)cc1 |
| InChI | InChI=1S/C27H19Cl2F3N6O4/c28-19-6-8-22(37-14-23(29)34-35-37)24(25(19)30)17-5-7-21(38(41)13-17)20(9-10-42-27(31)32)36-12-18(11-33-36)15-1-3-16(4-2-15)26(39)40/h1-8,11-14,20,27H,9-10H2,(H,39,40)/t20-/m0/s1 |
| InChIKey | PVJAHCIAMHCGCV-FQEVSTJZSA-N |
| XLogP | 5.79 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.39 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|