C8H8F8N2 — CID 16742295
2-(1,1,2,2,3,3,4,4-octafluorobutyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 16742295) has the molecular formula C8H8F8N2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4-octafluorobutyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(1,1,2,2,3,3,4,4-octafluorobutyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 16742295 |
| Molecular Formula | C8H8F8N2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4-octafluorobutyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C1=NCCCN1 |
| InChI | InChI=1S/C8H8F8N2/c9-4(10)6(11,12)8(15,16)7(13,14)5-17-2-1-3-18-5/h4H,1-3H2,(H,17,18) |
| InChIKey | YBYYPSBSDWPACG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|