C20H31NO2 — CID 16742458
6-[(2E,5E)-3,7-dimethylocta-2,5-dienyl]-4-methoxy-3-methyl-5-propyl-1H-pyridin-2-one (PubChem CID 16742458) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 6-[(2E,5E)-3,7-dimethylocta-2,5-dienyl]-4-methoxy-3-methyl-5-propyl-1H-pyridin-2-one.
| Compound Name | 6-[(2E,5E)-3,7-dimethylocta-2,5-dienyl]-4-methoxy-3-methyl-5-propyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 16742458 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 6-[(2E,5E)-3,7-dimethylocta-2,5-dienyl]-4-methoxy-3-methyl-5-propyl-1H-pyridin-2-one |
| SMILES | CCCc1c(C/C=C(\C)C/C=C/C(C)C)[nH]c(=O)c(C)c1OC |
| InChI | InChI=1S/C20H31NO2/c1-7-9-17-18(21-20(22)16(5)19(17)23-6)13-12-15(4)11-8-10-14(2)3/h8,10,12,14H,7,9,11,13H2,1-6H3,(H,21,22)/b10-8+,15-12+ |
| InChIKey | CXEJJNIHIKGTCH-VBONDNGNSA-N |
| XLogP | 4.74 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|