C26H34F3N5O4 — CID 167424965
3-[(1S)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide (PubChem CID 167424965) has the molecular formula C26H34F3N5O4 and a molecular weight of 537.58 g/mol. Its IUPAC name is 3-[(1S)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide.
| Compound Name | 3-[(1S)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
|---|---|
| PubChem CID | 167424965 |
| Molecular Formula | C26H34F3N5O4 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 3-[(1S)-1-cyano-2-[(3S)-2-oxopiperidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(F)(F)F)C(=O)N1CC2C3C=CC(C3)C2C1(C(N)=O)[C@@H](C#N)C[C@@H]1CCCNC1=O |
| InChI | InChI=1S/C26H34F3N5O4/c1-24(2,3)19(33-23(38)26(27,28)29)21(36)34-12-17-13-6-7-14(9-13)18(17)25(34,22(31)37)16(11-30)10-15-5-4-8-32-20(15)35/h6-7,13-19H,4-5,8-10,12H2,1-3H3,(H2,31,37)(H,32,35)(H,33,38)/t13?,14?,15-,16+,17?,18?,19+,25?/m0/s1 |
| InChIKey | XLNHDYDHGKSFJJ-UCLLTFPASA-N |
| XLogP | 1.64 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|