About 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one
7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one (PubChem CID 167425006) has the molecular formula C12H19F2NO
and a molecular weight of 231.29 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one.
Molecular Properties
| Compound Name | 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one |
| PubChem CID | 167425006 |
| Molecular Formula | C12H19F2NO |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one |
| SMILES | CC(C)(C)CC1CC2(CC(F)(F)C2)NC1=O |
| InChI | InChI=1S/C12H19F2NO/c1-10(2,3)4-8-5-11(15-9(8)16)6-12(13,14)7-11/h8H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | ACSHQXNEBXCLPQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one?
The IUPAC name of 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one (CID 167425006) is 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one.
What is the SMILES notation for 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one?
The canonical SMILES for 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one is CC(C)(C)CC1CC2(CC(F)(F)C2)NC1=O.
What is the InChIKey of 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one?
The InChIKey is ACSHQXNEBXCLPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO/c1-10(2,3)4-8-5-11(15-9(8)16)6-12(13,14)7-11/h8H,4-7H2,1-3H3,(H,15,16).
What are the key properties of 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one?
7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one has a molecular weight of 231.29 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-dimethylpropyl)-2,2-difluoro-5-azaspiro[3.4]octan-6-one is sourced from PubChem (CID 167425006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).