C14H26F3NO2 — CID 167425102
3,3,3-trifluoro-2-(hydroxymethyl)-2-methyl-N-(2,2,4,4-tetramethylpentan-3-yl)propanamide (PubChem CID 167425102) has the molecular formula C14H26F3NO2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(hydroxymethyl)-2-methyl-N-(2,2,4,4-tetramethylpentan-3-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-2-(hydroxymethyl)-2-methyl-N-(2,2,4,4-tetramethylpentan-3-yl)propanamide |
|---|---|
| PubChem CID | 167425102 |
| Molecular Formula | C14H26F3NO2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 3,3,3-trifluoro-2-(hydroxymethyl)-2-methyl-N-(2,2,4,4-tetramethylpentan-3-yl)propanamide |
| SMILES | CC(C)(C)C(NC(=O)C(C)(CO)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C14H26F3NO2/c1-11(2,3)9(12(4,5)6)18-10(20)13(7,8-19)14(15,16)17/h9,19H,8H2,1-7H3,(H,18,20) |
| InChIKey | TVIBDECFPFHJEH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |