C19H30N2O3 — CID 167425114
(1S,3aR,4S,7R,7aS)-2-[(2S)-2-amino-3-cyclopropyl-3-methylbutanoyl]-4,7-dimethyl-1,3,3a,4,7,7a-hexahydroisoindole-1-carboxylic acid (PubChem CID 167425114) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,3aR,4S,7R,7aS)-2-[(2S)-2-amino-3-cyclopropyl-3-methylbutanoyl]-4,7-dimethyl-1,3,3a,4,7,7a-hexahydroisoindole-1-carboxylic acid.
| Compound Name | (1S,3aR,4S,7R,7aS)-2-[(2S)-2-amino-3-cyclopropyl-3-methylbutanoyl]-4,7-dimethyl-1,3,3a,4,7,7a-hexahydroisoindole-1-carboxylic acid |
|---|---|
| PubChem CID | 167425114 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (1S,3aR,4S,7R,7aS)-2-[(2S)-2-amino-3-cyclopropyl-3-methylbutanoyl]-4,7-dimethyl-1,3,3a,4,7,7a-hexahydroisoindole-1-carboxylic acid |
| SMILES | C[C@@H]1C=C[C@H](C)[C@H]2CN(C(=O)[C@@H](N)C(C)(C)C3CC3)[C@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C19H30N2O3/c1-10-5-6-11(2)14-13(10)9-21(15(14)18(23)24)17(22)16(20)19(3,4)12-7-8-12/h5-6,10-16H,7-9,20H2,1-4H3,(H,23,24)/t10-,11+,13+,14-,15-,16+/m0/s1 |
| InChIKey | VAPFMYPYVBSJAP-BWWHORKDSA-N |
| XLogP | 2.12 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|