C15H18ClN3OS — CID 167425719
4-[[2-chloro-5-(2-methyl-1,3-thiazol-5-yl)-4-pyridinyl]amino]cyclohexan-1-ol (PubChem CID 167425719) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 4-[[2-chloro-5-(2-methyl-1,3-thiazol-5-yl)-4-pyridinyl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-chloro-5-(2-methyl-1,3-thiazol-5-yl)-4-pyridinyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 167425719 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-[[2-chloro-5-(2-methyl-1,3-thiazol-5-yl)-4-pyridinyl]amino]cyclohexan-1-ol |
| SMILES | Cc1ncc(-c2cnc(Cl)cc2NC2CCC(O)CC2)s1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-9-17-8-14(21-9)12-7-18-15(16)6-13(12)19-10-2-4-11(20)5-3-10/h6-8,10-11,20H,2-5H2,1H3,(H,18,19) |
| InChIKey | QGMXGCNUQJDQSS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|