C17H26O3 — CID 16742635
[(4S,4aS,5Z,7S,8S)-8-hydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl] acetate (PubChem CID 16742635) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(4S,4aS,5Z,7S,8S)-8-hydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl] acetate.
| Compound Name | [(4S,4aS,5Z,7S,8S)-8-hydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl] acetate |
|---|---|
| PubChem CID | 16742635 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(4S,4aS,5Z,7S,8S)-8-hydroxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C(C)=C\[C@@]2(C)C(=CCC[C@@H]2C)CC[C@@H]1O |
| InChI | InChI=1S/C17H26O3/c1-11-10-17(4)12(2)6-5-7-14(17)8-9-15(19)16(11)20-13(3)18/h7,10,12,15-16,19H,5-6,8-9H2,1-4H3/b11-10-/t12-,15-,16-,17+/m0/s1 |
| InChIKey | UPMMTQHHDKQSNI-JCORWKKKSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|