C17H19ClF3N3O2 — CID 167426766
N-[3-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]prop-2-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 167426766) has the molecular formula C17H19ClF3N3O2 and a molecular weight of 389.81 g/mol. Its IUPAC name is N-[3-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]prop-2-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167426766 |
| Molecular Formula | C17H19ClF3N3O2 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[3-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(CO)CCN(c2cc(Cl)ncc2C#CCNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H19ClF3N3O2/c1-16(11-25)4-7-24(8-5-16)13-9-14(18)23-10-12(13)3-2-6-22-15(26)17(19,20)21/h9-10,25H,4-8,11H2,1H3,(H,22,26) |
| InChIKey | IVEKHKBNUTWKTJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|