C20H23ClF3N3O2 — CID 167426952
1-[3-[2-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]ethynyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 167426952) has the molecular formula C20H23ClF3N3O2 and a molecular weight of 429.87 g/mol. Its IUPAC name is 1-[3-[2-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]ethynyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-[2-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]ethynyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 167426952 |
| Molecular Formula | C20H23ClF3N3O2 |
| Molecular Weight | 429.87 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-[3-[2-[6-chloro-4-[4-(hydroxymethyl)-4-methylpiperidin-1-yl]-3-pyridinyl]ethynyl]pyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1(CO)CCN(c2cc(Cl)ncc2C#CC2CCN(C(=O)C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C20H23ClF3N3O2/c1-19(13-28)5-8-26(9-6-19)16-10-17(21)25-11-15(16)3-2-14-4-7-27(12-14)18(29)20(22,23)24/h10-11,14,28H,4-9,12-13H2,1H3 |
| InChIKey | LEJPYVAUDZGKFE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.87 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|