C19H28O4 — CID 16742794
[(4S,4aS,5Z,7S,8S)-7-acetyloxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-8-yl] acetate (PubChem CID 16742794) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(4S,4aS,5Z,7S,8S)-7-acetyloxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-8-yl] acetate.
| Compound Name | [(4S,4aS,5Z,7S,8S)-7-acetyloxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-8-yl] acetate |
|---|---|
| PubChem CID | 16742794 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(4S,4aS,5Z,7S,8S)-7-acetyloxy-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulen-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2=CCC[C@H](C)[C@@]2(C)/C=C(/C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H28O4/c1-12-11-19(5)13(2)7-6-8-16(19)9-10-17(22-14(3)20)18(12)23-15(4)21/h8,11,13,17-18H,6-7,9-10H2,1-5H3/b12-11-/t13-,17-,18-,19+/m0/s1 |
| InChIKey | LKKOWPFRDNDSEA-NCEFMJJWSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|