C20H32O3 — CID 16742816
(1S,2'R,3aR,7aS)-2'-[(Z)-4-(methoxymethoxy)-4-methylpent-1-enyl]-7a-methylspiro[2,3,3a,5,6,7-hexahydroindene-1,1'-cyclopropane]-4-one (PubChem CID 16742816) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,2'R,3aR,7aS)-2'-[(Z)-4-(methoxymethoxy)-4-methylpent-1-enyl]-7a-methylspiro[2,3,3a,5,6,7-hexahydroindene-1,1'-cyclopropane]-4-one.
| Compound Name | (1S,2'R,3aR,7aS)-2'-[(Z)-4-(methoxymethoxy)-4-methylpent-1-enyl]-7a-methylspiro[2,3,3a,5,6,7-hexahydroindene-1,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 16742816 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,2'R,3aR,7aS)-2'-[(Z)-4-(methoxymethoxy)-4-methylpent-1-enyl]-7a-methylspiro[2,3,3a,5,6,7-hexahydroindene-1,1'-cyclopropane]-4-one |
| SMILES | COCOC(C)(C)C/C=C\[C@H]1C[C@@]12CC[C@H]1C(=O)CCC[C@@]12C |
| InChI | InChI=1S/C20H32O3/c1-18(2,23-14-22-4)10-5-7-15-13-20(15)12-9-16-17(21)8-6-11-19(16,20)3/h5,7,15-16H,6,8-14H2,1-4H3/b7-5-/t15-,16-,19-,20-/m0/s1 |
| InChIKey | CQSIKUYTKYLSIH-DTIHDNMJSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|