C24H21N5O — CID 167428922
4-[4-(2-aminoethyl)phenyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)oxybenzonitrile (PubChem CID 167428922) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)phenyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)oxybenzonitrile.
| Compound Name | 4-[4-(2-aminoethyl)phenyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 167428922 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-[4-(2-aminoethyl)phenyl]-3-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)oxybenzonitrile |
| SMILES | Cn1nc(-c2ccccn2)cc1Oc1cc(C#N)ccc1-c1ccc(CCN)cc1 |
| InChI | InChI=1S/C24H21N5O/c1-29-24(15-22(28-29)21-4-2-3-13-27-21)30-23-14-18(16-26)7-10-20(23)19-8-5-17(6-9-19)11-12-25/h2-10,13-15H,11-12,25H2,1H3 |
| InChIKey | NVFOREAVICZBLP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |