C23H29N7O2 — CID 167429693
4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[3-[4-methoxybutyl(methyl)amino]-1-methylpyrazol-5-yl]oxybenzonitrile (PubChem CID 167429693) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[3-[4-methoxybutyl(methyl)amino]-1-methylpyrazol-5-yl]oxybenzonitrile.
| Compound Name | 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[3-[4-methoxybutyl(methyl)amino]-1-methylpyrazol-5-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 167429693 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-[5-(2-aminoethyl)pyrimidin-2-yl]-3-[3-[4-methoxybutyl(methyl)amino]-1-methylpyrazol-5-yl]oxybenzonitrile |
| SMILES | COCCCCN(C)c1cc(Oc2cc(C#N)ccc2-c2ncc(CCN)cn2)n(C)n1 |
| InChI | InChI=1S/C23H29N7O2/c1-29(10-4-5-11-31-3)21-13-22(30(2)28-21)32-20-12-17(14-25)6-7-19(20)23-26-15-18(8-9-24)16-27-23/h6-7,12-13,15-16H,4-5,8-11,24H2,1-3H3 |
| InChIKey | UFXQONCPSGVMRL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|