About 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one
5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one (PubChem CID 16742973) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one.
Molecular Properties
| Compound Name | 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one |
| PubChem CID | 16742973 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one |
| SMILES | O=c1cc(CO)occ1C(O)CO |
| InChI | InChI=1S/C8H10O5/c9-2-5-1-7(11)6(4-13-5)8(12)3-10/h1,4,8-10,12H,2-3H2 |
| InChIKey | CBFLNAVONDVOHN-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one?
The IUPAC name of 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one (CID 16742973) is 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one.
What is the SMILES notation for 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one?
The canonical SMILES for 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one is O=c1cc(CO)occ1C(O)CO.
What is the InChIKey of 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one?
The InChIKey is CBFLNAVONDVOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c9-2-5-1-7(11)6(4-13-5)8(12)3-10/h1,4,8-10,12H,2-3H2.
What are the key properties of 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one?
5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one has a molecular weight of 186.16 g/mol, XLogP of -0.84, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-dihydroxyethyl)-2-(hydroxymethyl)pyran-4-one is sourced from PubChem (CID 16742973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).