About 1-oxaspiro[4.6]undecane
1-oxaspiro[4.6]undecane (PubChem CID 16743008) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 1-oxaspiro[4.6]undecane.
Molecular Properties
| Compound Name | 1-oxaspiro[4.6]undecane |
| PubChem CID | 16743008 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 1-oxaspiro[4.6]undecane |
| SMILES | C1CCCC2(CC1)CCCO2 |
| InChI | InChI=1S/C10H18O/c1-2-4-7-10(6-3-1)8-5-9-11-10/h1-9H2 |
| InChIKey | NPCVDXJFRNIQGT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-oxaspiro[4.6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxaspiro[4.6]undecane?
The IUPAC name of 1-oxaspiro[4.6]undecane (CID 16743008) is 1-oxaspiro[4.6]undecane.
What is the SMILES notation for 1-oxaspiro[4.6]undecane?
The canonical SMILES for 1-oxaspiro[4.6]undecane is C1CCCC2(CC1)CCCO2.
What is the InChIKey of 1-oxaspiro[4.6]undecane?
The InChIKey is NPCVDXJFRNIQGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-2-4-7-10(6-3-1)8-5-9-11-10/h1-9H2.
What are the key properties of 1-oxaspiro[4.6]undecane?
1-oxaspiro[4.6]undecane has a molecular weight of 154.25 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxaspiro[4.6]undecane is sourced from PubChem (CID 16743008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).