C22H26N2O2 — CID 167431278
1,3-bis(2-phenylpropan-2-yl)imidazol-1-ium formate (PubChem CID 167431278) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1,3-bis(2-phenylpropan-2-yl)imidazol-1-ium formate.
| Compound Name | 1,3-bis(2-phenylpropan-2-yl)imidazol-1-ium formate |
|---|---|
| PubChem CID | 167431278 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1,3-bis(2-phenylpropan-2-yl)imidazol-1-ium formate |
| SMILES | CC(C)(c1ccccc1)n1cc[n+](C(C)(C)c2ccccc2)c1.O=C[O-] |
| InChI | InChI=1S/C21H25N2.CH2O2/c1-20(2,18-11-7-5-8-12-18)22-15-16-23(17-22)21(3,4)19-13-9-6-10-14-19;2-1-3/h5-17H,1-4H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | IKCNPJFXFLPALQ-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|