C26H27F3N4O2 — CID 167431555
(3S,3aS,5S,6aS)-3-[2-(4-methoxyphenoxy)ethyl]-2-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 167431555) has the molecular formula C26H27F3N4O2 and a molecular weight of 484.52 g/mol. Its IUPAC name is (3S,3aS,5S,6aS)-3-[2-(4-methoxyphenoxy)ethyl]-2-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3S,3aS,5S,6aS)-3-[2-(4-methoxyphenoxy)ethyl]-2-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 167431555 |
| Molecular Formula | C26H27F3N4O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (3S,3aS,5S,6aS)-3-[2-(4-methoxyphenoxy)ethyl]-2-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | COc1ccc(OCC[C@H]2[C@H]3C[C@@H](N)C[C@@H]3CN2c2ccc(-c3cc(F)cc(F)c3F)nn2)cc1 |
| InChI | InChI=1S/C26H27F3N4O2/c1-34-18-2-4-19(5-3-18)35-9-8-24-20-13-17(30)10-15(20)14-33(24)25-7-6-23(31-32-25)21-11-16(27)12-22(28)26(21)29/h2-7,11-12,15,17,20,24H,8-10,13-14,30H2,1H3/t15-,17+,20+,24+/m1/s1 |
| InChIKey | LXOMTMMGFIOQDM-QHHRADHPSA-N |
| XLogP | 4.58 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|