About 1-chloro-1,2,4-triazol-3-amine
1-chloro-1,2,4-triazol-3-amine (PubChem CID 167431843) has the molecular formula C2H3ClN4
and a molecular weight of 118.53 g/mol. Its IUPAC name is 1-chloro-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-chloro-1,2,4-triazol-3-amine |
| PubChem CID | 167431843 |
| Molecular Formula | C2H3ClN4 |
| Molecular Weight | 118.53 g/mol |
| Exact Mass | 118.00 |
| IUPAC Name | 1-chloro-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(Cl)n1 |
| InChI | InChI=1S/C2H3ClN4/c3-7-1-5-2(4)6-7/h1H,(H2,4,6) |
| InChIKey | KWGDIRSSNVCYLP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.53 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,2,4-triazol-3-amine?
The IUPAC name of 1-chloro-1,2,4-triazol-3-amine (CID 167431843) is 1-chloro-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-chloro-1,2,4-triazol-3-amine?
The canonical SMILES for 1-chloro-1,2,4-triazol-3-amine is Nc1ncn(Cl)n1.
What is the InChIKey of 1-chloro-1,2,4-triazol-3-amine?
The InChIKey is KWGDIRSSNVCYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3ClN4/c3-7-1-5-2(4)6-7/h1H,(H2,4,6).
What are the key properties of 1-chloro-1,2,4-triazol-3-amine?
1-chloro-1,2,4-triazol-3-amine has a molecular weight of 118.53 g/mol, XLogP of -0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,2,4-triazol-3-amine is sourced from PubChem (CID 167431843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).