C15H15FN4OS — CID 167431851
6-(3-fluorophenyl)-7-[(1S)-1-hydrazinylethyl]-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 167431851) has the molecular formula C15H15FN4OS and a molecular weight of 318.38 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-7-[(1S)-1-hydrazinylethyl]-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 6-(3-fluorophenyl)-7-[(1S)-1-hydrazinylethyl]-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 167431851 |
| Molecular Formula | C15H15FN4OS |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 6-(3-fluorophenyl)-7-[(1S)-1-hydrazinylethyl]-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1csc2nc([C@H](C)NN)c(-c3cccc(F)c3)c(=O)n12 |
| InChI | InChI=1S/C15H15FN4OS/c1-8-7-22-15-18-13(9(2)19-17)12(14(21)20(8)15)10-4-3-5-11(16)6-10/h3-7,9,19H,17H2,1-2H3/t9-/m0/s1 |
| InChIKey | MOMGNAXGTYHQKI-VIFPVBQESA-N |
| XLogP | 2.39 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|