C10H18N4O5S — CID 167432323
(2S,5R)-6-hydroxy-N'-(2-methoxyethylsulfonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432323) has the molecular formula C10H18N4O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-N'-(2-methoxyethylsulfonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-hydroxy-N'-(2-methoxyethylsulfonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432323 |
| Molecular Formula | C10H18N4O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (2S,5R)-6-hydroxy-N'-(2-methoxyethylsulfonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | COCCS(=O)(=O)/N=C(\N)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C10H18N4O5S/c1-19-4-5-20(17,18)12-9(11)8-3-2-7-6-13(8)10(15)14(7)16/h7-8,16H,2-6H2,1H3,(H2,11,12)/t7-,8+/m1/s1 |
| InChIKey | ZVUQQNYTMZFZIN-SFYZADRCSA-N |
| XLogP | -1.02 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|