C10H16N4O4S — CID 167432332
(2S,5R)-N'-cyclopropylsulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432332) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is (2S,5R)-N'-cyclopropylsulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-N'-cyclopropylsulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432332 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (2S,5R)-N'-cyclopropylsulfonyl-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(=O)(=O)C1CC1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C10H16N4O4S/c11-9(12-19(17,18)7-2-3-7)8-4-1-6-5-13(8)10(15)14(6)16/h6-8,16H,1-5H2,(H2,11,12)/t6-,8+/m1/s1 |
| InChIKey | GMWPIDDFHXTHFQ-SVRRBLITSA-N |
| XLogP | -0.51 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|