C17H27NO6 — CID 16743244
ethyl 2-[(2R,3R,4aS,6R,8Z,10aS)-6-(dimethylcarbamoyl)-3-hydroxy-2,3,4,4a,6,7,10,10a-octahydropyrano[3,2-b]oxocin-2-yl]acetate (PubChem CID 16743244) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is ethyl 2-[(2R,3R,4aS,6R,8Z,10aS)-6-(dimethylcarbamoyl)-3-hydroxy-2,3,4,4a,6,7,10,10a-octahydropyrano[3,2-b]oxocin-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,3R,4aS,6R,8Z,10aS)-6-(dimethylcarbamoyl)-3-hydroxy-2,3,4,4a,6,7,10,10a-octahydropyrano[3,2-b]oxocin-2-yl]acetate |
|---|---|
| PubChem CID | 16743244 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | ethyl 2-[(2R,3R,4aS,6R,8Z,10aS)-6-(dimethylcarbamoyl)-3-hydroxy-2,3,4,4a,6,7,10,10a-octahydropyrano[3,2-b]oxocin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1O[C@H]2C/C=C\C[C@H](C(=O)N(C)C)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C17H27NO6/c1-4-22-16(20)10-14-11(19)9-15-12(23-14)7-5-6-8-13(24-15)17(21)18(2)3/h5-6,11-15,19H,4,7-10H2,1-3H3/b6-5-/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | JBDZLJRGOLSVDE-PJDRBYPZSA-N |
| XLogP | 0.65 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|