C24H19F3O5 — CID 16743270
2-[4-(4-propylphenyl)phenyl]-2-(3,4,5-trifluorophenoxy)propanedioic acid (PubChem CID 16743270) has the molecular formula C24H19F3O5 and a molecular weight of 444.41 g/mol. Its IUPAC name is 2-[4-(4-propylphenyl)phenyl]-2-(3,4,5-trifluorophenoxy)propanedioic acid.
| Compound Name | 2-[4-(4-propylphenyl)phenyl]-2-(3,4,5-trifluorophenoxy)propanedioic acid |
|---|---|
| PubChem CID | 16743270 |
| Molecular Formula | C24H19F3O5 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[4-(4-propylphenyl)phenyl]-2-(3,4,5-trifluorophenoxy)propanedioic acid |
| SMILES | CCCc1ccc(-c2ccc(C(Oc3cc(F)c(F)c(F)c3)(C(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H19F3O5/c1-2-3-14-4-6-15(7-5-14)16-8-10-17(11-9-16)24(22(28)29,23(30)31)32-18-12-19(25)21(27)20(26)13-18/h4-13H,2-3H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | HLMWYTUPQDZNIM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|