C19H15BrF2N4O3 — CID 167432851
(13R)-N-[4-bromo-2-(difluoromethoxy)phenyl]-13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide (PubChem CID 167432851) has the molecular formula C19H15BrF2N4O3 and a molecular weight of 465.25 g/mol. Its IUPAC name is (13R)-N-[4-bromo-2-(difluoromethoxy)phenyl]-13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide.
| Compound Name | (13R)-N-[4-bromo-2-(difluoromethoxy)phenyl]-13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 167432851 |
| Molecular Formula | C19H15BrF2N4O3 |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | (13R)-N-[4-bromo-2-(difluoromethoxy)phenyl]-13-methyl-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide |
| SMILES | C[C@@H]1CNC(=O)c2cc3ccc(C(=O)Nc4ccc(Br)cc4OC(F)F)nc3n21 |
| InChI | InChI=1S/C19H15BrF2N4O3/c1-9-8-23-18(28)14-6-10-2-4-13(24-16(10)26(9)14)17(27)25-12-5-3-11(20)7-15(12)29-19(21)22/h2-7,9,19H,8H2,1H3,(H,23,28)(H,25,27)/t9-/m1/s1 |
| InChIKey | UZISVQMSGPWCJD-SECBINFHSA-N |
| XLogP | 3.96 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |