About 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one
5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one (PubChem CID 16743287) has the molecular formula C27H22N4O2
and a molecular weight of 434.50 g/mol. Its IUPAC name is 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one |
| PubChem CID | 16743287 |
| Molecular Formula | C27H22N4O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one |
| SMILES | COc1ccc(-c2cc(Cc3cn(-c4ccccc4)nc3-c3ccccc3)c(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C27H22N4O2/c1-33-24-14-12-19(13-15-24)25-17-21(27(32)29-28-25)16-22-18-31(23-10-6-3-7-11-23)30-26(22)20-8-4-2-5-9-20/h2-15,17-18H,16H2,1H3,(H,29,32) |
| InChIKey | PFVDCHZRHHDEAC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one?
The IUPAC name of 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one (CID 16743287) is 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one.
What is the SMILES notation for 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one?
The canonical SMILES for 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one is COc1ccc(-c2cc(Cc3cn(-c4ccccc4)nc3-c3ccccc3)c(=O)[nH]n2)cc1.
What is the InChIKey of 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one?
The InChIKey is PFVDCHZRHHDEAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N4O2/c1-33-24-14-12-19(13-15-24)25-17-21(27(32)29-28-25)16-22-18-31(23-10-6-3-7-11-23)30-26(22)20-8-4-2-5-9-20/h2-15,17-18H,16H2,1H3,(H,29,32).
What are the key properties of 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one?
5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one has a molecular weight of 434.50 g/mol, XLogP of 4.89, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-1H-pyridazin-6-one is sourced from PubChem (CID 16743287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).