About 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine
2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine (PubChem CID 167433054) has the molecular formula C14H11BBrNO2
and a molecular weight of 315.96 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine |
| PubChem CID | 167433054 |
| Molecular Formula | C14H11BBrNO2 |
| Molecular Weight | 315.96 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine |
| SMILES | Brc1ccc(B2OCC(c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C14H11BBrNO2/c16-13-8-6-12(7-9-13)15-18-10-14(17-19-15)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | XMTIBDNWZZSMGO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.96 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine?
The IUPAC name of 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine (CID 167433054) is 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine.
What is the SMILES notation for 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine?
The canonical SMILES for 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine is Brc1ccc(B2OCC(c3ccccc3)=NO2)cc1.
What is the InChIKey of 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine?
The InChIKey is XMTIBDNWZZSMGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BBrNO2/c16-13-8-6-12(7-9-13)15-18-10-14(17-19-15)11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine?
2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine has a molecular weight of 315.96 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine is sourced from PubChem (CID 167433054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).