C17H14F5NO6S2 — CID 167433355
[4-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-yl] trifluoromethanesulfonate (PubChem CID 167433355) has the molecular formula C17H14F5NO6S2 and a molecular weight of 487.42 g/mol. Its IUPAC name is [4-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-yl] trifluoromethanesulfonate.
| Compound Name | [4-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 167433355 |
| Molecular Formula | C17H14F5NO6S2 |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | [4-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-yl] trifluoromethanesulfonate |
| SMILES | CCS(=O)(=O)N1CCc2c(Oc3ccc(F)cc3F)cc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C17H14F5NO6S2/c1-2-30(24,25)23-6-5-12-14(23)8-11(29-31(26,27)17(20,21)22)9-16(12)28-15-4-3-10(18)7-13(15)19/h3-4,7-9H,2,5-6H2,1H3 |
| InChIKey | KIRSNKMEZLGWNF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|