About 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol
5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol (PubChem CID 167433379) has the molecular formula C16H15F2NO4S
and a molecular weight of 355.36 g/mol. Its IUPAC name is 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol.
Molecular Properties
| Compound Name | 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol |
| PubChem CID | 167433379 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol |
| SMILES | CCS(=O)(=O)N1CCc2cc(Oc3ccc(F)cc3F)c(O)cc21 |
| InChI | InChI=1S/C16H15F2NO4S/c1-2-24(21,22)19-6-5-10-7-16(14(20)9-13(10)19)23-15-4-3-11(17)8-12(15)18/h3-4,7-9,20H,2,5-6H2,1H3 |
| InChIKey | SVXOXYULQKZFDH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol?
The IUPAC name of 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol (CID 167433379) is 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol.
What is the SMILES notation for 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol?
The canonical SMILES for 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol is CCS(=O)(=O)N1CCc2cc(Oc3ccc(F)cc3F)c(O)cc21.
What is the InChIKey of 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol?
The InChIKey is SVXOXYULQKZFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO4S/c1-2-24(21,22)19-6-5-10-7-16(14(20)9-13(10)19)23-15-4-3-11(17)8-12(15)18/h3-4,7-9,20H,2,5-6H2,1H3.
What are the key properties of 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol?
5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol has a molecular weight of 355.36 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluorophenoxy)-1-ethylsulfonyl-2,3-dihydroindol-6-ol is sourced from PubChem (CID 167433379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).