About 5,6-dibromochromen-4-one
5,6-dibromochromen-4-one (PubChem CID 167433686) has the molecular formula C9H4Br2O2
and a molecular weight of 303.94 g/mol. Its IUPAC name is 5,6-dibromochromen-4-one.
Molecular Properties
| Compound Name | 5,6-dibromochromen-4-one |
| PubChem CID | 167433686 |
| Molecular Formula | C9H4Br2O2 |
| Molecular Weight | 303.94 g/mol |
| Exact Mass | 301.86 |
| IUPAC Name | 5,6-dibromochromen-4-one |
| SMILES | O=c1ccoc2ccc(Br)c(Br)c12 |
| InChI | InChI=1S/C9H4Br2O2/c10-5-1-2-7-8(9(5)11)6(12)3-4-13-7/h1-4H |
| InChIKey | MOWYJOGRZHVPLL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.94 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dibromochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dibromochromen-4-one?
The IUPAC name of 5,6-dibromochromen-4-one (CID 167433686) is 5,6-dibromochromen-4-one.
What is the SMILES notation for 5,6-dibromochromen-4-one?
The canonical SMILES for 5,6-dibromochromen-4-one is O=c1ccoc2ccc(Br)c(Br)c12.
What is the InChIKey of 5,6-dibromochromen-4-one?
The InChIKey is MOWYJOGRZHVPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Br2O2/c10-5-1-2-7-8(9(5)11)6(12)3-4-13-7/h1-4H.
What are the key properties of 5,6-dibromochromen-4-one?
5,6-dibromochromen-4-one has a molecular weight of 303.94 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dibromochromen-4-one is sourced from PubChem (CID 167433686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).