About 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one
6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one (PubChem CID 167433699) has the molecular formula C12H9Br2FO
and a molecular weight of 348.01 g/mol. Its IUPAC name is 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one.
Molecular Properties
| Compound Name | 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one |
| PubChem CID | 167433699 |
| Molecular Formula | C12H9Br2FO |
| Molecular Weight | 348.01 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one |
| SMILES | CC1(C)C(F)=CC(=O)c2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C12H9Br2FO/c1-12(2)7-3-6(13)4-8(14)11(7)9(16)5-10(12)15/h3-5H,1-2H3 |
| InChIKey | MGGMONHRKDVRJS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.01 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one?
The IUPAC name of 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one (CID 167433699) is 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one.
What is the SMILES notation for 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one?
The canonical SMILES for 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one is CC1(C)C(F)=CC(=O)c2c(Br)cc(Br)cc21.
What is the InChIKey of 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one?
The InChIKey is MGGMONHRKDVRJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br2FO/c1-12(2)7-3-6(13)4-8(14)11(7)9(16)5-10(12)15/h3-5H,1-2H3.
What are the key properties of 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one?
6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one has a molecular weight of 348.01 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-3-fluoro-4,4-dimethylnaphthalen-1-one is sourced from PubChem (CID 167433699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).