C10H6FNO2 — CID 16743432
(4-fluorophenyl)-(1,3-oxazol-2-yl)methanone (PubChem CID 16743432) has the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. Its IUPAC name is (4-fluorophenyl)-(1,3-oxazol-2-yl)methanone.
| Compound Name | (4-fluorophenyl)-(1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 16743432 |
| Molecular Formula | C10H6FNO2 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | (4-fluorophenyl)-(1,3-oxazol-2-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1ncco1 |
| InChI | InChI=1S/C10H6FNO2/c11-8-3-1-7(2-4-8)9(13)10-12-5-6-14-10/h1-6H |
| InChIKey | MZUVMBGDHXJAKO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |