About N-butan-2-yl-1,3-benzodioxol-2-amine
N-butan-2-yl-1,3-benzodioxol-2-amine (PubChem CID 167434503) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-butan-2-yl-1,3-benzodioxol-2-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-1,3-benzodioxol-2-amine |
| PubChem CID | 167434503 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-butan-2-yl-1,3-benzodioxol-2-amine |
| SMILES | CCC(C)NC1Oc2ccccc2O1 |
| InChI | InChI=1S/C11H15NO2/c1-3-8(2)12-11-13-9-6-4-5-7-10(9)14-11/h4-8,11-12H,3H2,1-2H3 |
| InChIKey | WZZJPWGFCUFJME-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-1,3-benzodioxol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1,3-benzodioxol-2-amine?
The IUPAC name of N-butan-2-yl-1,3-benzodioxol-2-amine (CID 167434503) is N-butan-2-yl-1,3-benzodioxol-2-amine.
What is the SMILES notation for N-butan-2-yl-1,3-benzodioxol-2-amine?
The canonical SMILES for N-butan-2-yl-1,3-benzodioxol-2-amine is CCC(C)NC1Oc2ccccc2O1.
What is the InChIKey of N-butan-2-yl-1,3-benzodioxol-2-amine?
The InChIKey is WZZJPWGFCUFJME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-3-8(2)12-11-13-9-6-4-5-7-10(9)14-11/h4-8,11-12H,3H2,1-2H3.
What are the key properties of N-butan-2-yl-1,3-benzodioxol-2-amine?
N-butan-2-yl-1,3-benzodioxol-2-amine has a molecular weight of 193.25 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1,3-benzodioxol-2-amine is sourced from PubChem (CID 167434503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).