About 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline
8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline (PubChem CID 167435112) has the molecular formula C29H26F3N
and a molecular weight of 445.53 g/mol. Its IUPAC name is 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline.
Molecular Properties
| Compound Name | 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline |
| PubChem CID | 167435112 |
| Molecular Formula | C29H26F3N |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)C1=C(c3ccccc3)c3cc(C(F)(F)F)ccc3C1=N2 |
| InChI | InChI=1S/C29H26F3N/c1-27(2,3)18-12-14-23-22(16-18)28(4,5)25-24(17-9-7-6-8-10-17)21-15-19(29(30,31)32)11-13-20(21)26(25)33-23/h6-16H,1-5H3 |
| InChIKey | PXSYECLWAJVWDL-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline?
The IUPAC name of 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline (CID 167435112) is 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline.
What is the SMILES notation for 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline?
The canonical SMILES for 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline is CC(C)(C)c1ccc2c(c1)C(C)(C)C1=C(c3ccccc3)c3cc(C(F)(F)F)ccc3C1=N2.
What is the InChIKey of 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline?
The InChIKey is PXSYECLWAJVWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26F3N/c1-27(2,3)18-12-14-23-22(16-18)28(4,5)25-24(17-9-7-6-8-10-17)21-15-19(29(30,31)32)11-13-20(21)26(25)33-23/h6-16H,1-5H3.
What are the key properties of 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline?
8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline has a molecular weight of 445.53 g/mol, XLogP of 8.23, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-10,10-dimethyl-11-phenyl-2-(trifluoromethyl)indeno[1,2-b]quinoline is sourced from PubChem (CID 167435112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).