C18H9F9N2O — CID 16743532
5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole (PubChem CID 16743532) has the molecular formula C18H9F9N2O and a molecular weight of 440.27 g/mol. Its IUPAC name is 5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 16743532 |
| Molecular Formula | C18H9F9N2O |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2c(-c3ccccc3)nc(F)c(C(F)(F)F)c2C(F)(F)C(F)(F)F)on1 |
| InChI | InChI=1S/C18H9F9N2O/c1-8-7-10(30-29-8)11-12(16(20,21)18(25,26)27)13(17(22,23)24)15(19)28-14(11)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | MFLPLTAMGTZOOS-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|