C19H11F9N2O — CID 16743533
5-[6-fluoro-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole (PubChem CID 16743533) has the molecular formula C19H11F9N2O and a molecular weight of 454.29 g/mol. Its IUPAC name is 5-[6-fluoro-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[6-fluoro-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 16743533 |
| Molecular Formula | C19H11F9N2O |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 5-[6-fluoro-2-(4-methylphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1ccc(-c2nc(F)c(C(F)(F)F)c(C(F)(F)C(F)(F)F)c2-c2cc(C)no2)cc1 |
| InChI | InChI=1S/C19H11F9N2O/c1-8-3-5-10(6-4-8)15-12(11-7-9(2)30-31-11)13(17(21,22)19(26,27)28)14(16(20)29-15)18(23,24)25/h3-7H,1-2H3 |
| InChIKey | XEQHRMZAWUNBMR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|