C19H8F12N2O — CID 16743535
5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]-3-methyl-1,2-oxazole (PubChem CID 16743535) has the molecular formula C19H8F12N2O and a molecular weight of 508.26 g/mol. Its IUPAC name is 5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 16743535 |
| Molecular Formula | C19H8F12N2O |
| Molecular Weight | 508.26 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 5-[6-fluoro-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2c(-c3ccc(C(F)(F)F)cc3)nc(F)c(C(F)(F)F)c2C(F)(F)C(F)(F)F)on1 |
| InChI | InChI=1S/C19H8F12N2O/c1-7-6-10(34-33-7)11-12(16(21,22)19(29,30)31)13(18(26,27)28)15(20)32-14(11)8-2-4-9(5-3-8)17(23,24)25/h2-6H,1H3 |
| InChIKey | UBFCGVHEKVIASQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.26 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|