C18H26N2O — CID 16743539
(2R)-2-[[(2E,4E)-5-(diethylamino)-2-methylpenta-2,4-dienylidene]amino]-2-phenylethanol (PubChem CID 16743539) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (2R)-2-[[(2E,4E)-5-(diethylamino)-2-methylpenta-2,4-dienylidene]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[[(2E,4E)-5-(diethylamino)-2-methylpenta-2,4-dienylidene]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 16743539 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (2R)-2-[[(2E,4E)-5-(diethylamino)-2-methylpenta-2,4-dienylidene]amino]-2-phenylethanol |
| SMILES | CCN(/C=C/C=C(C)/C=N/[C@@H](CO)c1ccccc1)CC |
| InChI | InChI=1S/C18H26N2O/c1-4-20(5-2)13-9-10-16(3)14-19-18(15-21)17-11-7-6-8-12-17/h6-14,18,21H,4-5,15H2,1-3H3/b13-9+,16-10+,19-14+/t18-/m0/s1 |
| InChIKey | LZJLGPJDRYJVHQ-RRPYYXDUSA-N |
| XLogP | 3.59 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|