C20H14F5N3O2 — CID 167436045
4-(difluoromethyl)-3-formyl-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 167436045) has the molecular formula C20H14F5N3O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-formyl-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(difluoromethyl)-3-formyl-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 167436045 |
| Molecular Formula | C20H14F5N3O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-(difluoromethyl)-3-formyl-N-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cn(-c2cc(NC(=O)c3ccc(C(F)F)c(C=O)c3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C20H14F5N3O2/c1-11-8-28(10-26-11)16-6-14(20(23,24)25)5-15(7-16)27-19(30)12-2-3-17(18(21)22)13(4-12)9-29/h2-10,18H,1H3,(H,27,30) |
| InChIKey | FAHOLQVFRUJOKN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|