C18H21BN4O2 — CID 167436094
[7-(1-benzylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-2-yl]boronic acid (PubChem CID 167436094) has the molecular formula C18H21BN4O2 and a molecular weight of 336.20 g/mol. Its IUPAC name is [7-(1-benzylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-2-yl]boronic acid.
| Compound Name | [7-(1-benzylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 167436094 |
| Molecular Formula | C18H21BN4O2 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [7-(1-benzylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-2-yl]boronic acid |
| SMILES | OB(O)c1cc2nccc(C3CCCN(Cc4ccccc4)C3)n2n1 |
| InChI | InChI=1S/C18H21BN4O2/c24-19(25)17-11-18-20-9-8-16(23(18)21-17)15-7-4-10-22(13-15)12-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,15,24-25H,4,7,10,12-13H2 |
| InChIKey | AHMUSSCOKSNSHO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|