C16H13ClN4O2 — CID 167436244
3-[1-(6-chloroimidazo[1,2-b]pyridazin-8-yl)azetidin-3-yl]benzoic acid (PubChem CID 167436244) has the molecular formula C16H13ClN4O2 and a molecular weight of 328.76 g/mol. Its IUPAC name is 3-[1-(6-chloroimidazo[1,2-b]pyridazin-8-yl)azetidin-3-yl]benzoic acid.
| Compound Name | 3-[1-(6-chloroimidazo[1,2-b]pyridazin-8-yl)azetidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 167436244 |
| Molecular Formula | C16H13ClN4O2 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 3-[1-(6-chloroimidazo[1,2-b]pyridazin-8-yl)azetidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2CN(c3cc(Cl)nn4ccnc34)C2)c1 |
| InChI | InChI=1S/C16H13ClN4O2/c17-14-7-13(15-18-4-5-21(15)19-14)20-8-12(9-20)10-2-1-3-11(6-10)16(22)23/h1-7,12H,8-9H2,(H,22,23) |
| InChIKey | SFEUDYMFWXJHGP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |