About 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine
8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine (PubChem CID 167436348) has the molecular formula C20H17N5
and a molecular weight of 327.39 g/mol. Its IUPAC name is 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine |
| PubChem CID | 167436348 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine |
| SMILES | c1ccc(C[C@@H]2C[C@H]2c2cc(-c3cncnc3)nn3ccnc23)cc1 |
| InChI | InChI=1S/C20H17N5/c1-2-4-14(5-3-1)8-15-9-17(15)18-10-19(16-11-21-13-22-12-16)24-25-7-6-23-20(18)25/h1-7,10-13,15,17H,8-9H2/t15-,17-/m1/s1 |
| InChIKey | PHTLEHFBWBIYNJ-NVXWUHKLSA-N |
| XLogP | 3.53 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine?
The IUPAC name of 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine (CID 167436348) is 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine?
The canonical SMILES for 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine is c1ccc(C[C@@H]2C[C@H]2c2cc(-c3cncnc3)nn3ccnc23)cc1.
What is the InChIKey of 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine?
The InChIKey is PHTLEHFBWBIYNJ-NVXWUHKLSA-N. The full InChI is InChI=1S/C20H17N5/c1-2-4-14(5-3-1)8-15-9-17(15)18-10-19(16-11-21-13-22-12-16)24-25-7-6-23-20(18)25/h1-7,10-13,15,17H,8-9H2/t15-,17-/m1/s1.
What are the key properties of 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine?
8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine has a molecular weight of 327.39 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(1R,2S)-2-benzylcyclopropyl]-6-pyrimidin-5-ylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 167436348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).