C33H43BN2O5 — CID 167437022
tert-butyl 1-[[6-cyclopropyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazol-5-yl]methyl]pyrrolidine-3-carboxylate (PubChem CID 167437022) has the molecular formula C33H43BN2O5 and a molecular weight of 558.53 g/mol. Its IUPAC name is tert-butyl 1-[[6-cyclopropyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazol-5-yl]methyl]pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl 1-[[6-cyclopropyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazol-5-yl]methyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 167437022 |
| Molecular Formula | C33H43BN2O5 |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | tert-butyl 1-[[6-cyclopropyl-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazol-5-yl]methyl]pyrrolidine-3-carboxylate |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cccc1-c1nc2cc(CN3CCC(C(=O)OC(C)(C)C)C3)c(C3CC3)cc2o1 |
| InChI | InChI=1S/C33H43BN2O5/c1-20-24(10-9-11-26(20)34-40-32(5,6)33(7,8)41-34)29-35-27-16-23(25(21-12-13-21)17-28(27)38-29)19-36-15-14-22(18-36)30(37)39-31(2,3)4/h9-11,16-17,21-22H,12-15,18-19H2,1-8H3 |
| InChIKey | YOOATWQHBIVKAI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|