C37H41N5O8S — CID 167437155
2-(2,6-dihydroxypiperidin-3-yl)-5-[3-[4-[2-[4-[(2-methylsulfonylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione (PubChem CID 167437155) has the molecular formula C37H41N5O8S and a molecular weight of 715.83 g/mol. Its IUPAC name is 2-(2,6-dihydroxypiperidin-3-yl)-5-[3-[4-[2-[4-[(2-methylsulfonylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dihydroxypiperidin-3-yl)-5-[3-[4-[2-[4-[(2-methylsulfonylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167437155 |
| Molecular Formula | C37H41N5O8S |
| Molecular Weight | 715.83 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 2-(2,6-dihydroxypiperidin-3-yl)-5-[3-[4-[2-[4-[(2-methylsulfonylpyrimidin-4-yl)methoxy]phenyl]propan-2-yl]phenoxy]propylamino]isoindole-1,3-dione |
| SMILES | CC(C)(c1ccc(OCCCNc2ccc3c(c2)C(=O)N(C2CCC(O)NC2O)C3=O)cc1)c1ccc(OCc2ccnc(S(C)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C37H41N5O8S/c1-37(2,24-7-12-28(13-8-24)50-22-26-17-19-39-36(40-26)51(3,47)48)23-5-10-27(11-6-23)49-20-4-18-38-25-9-14-29-30(21-25)35(46)42(34(29)45)31-15-16-32(43)41-33(31)44/h5-14,17,19,21,31-33,38,41,43-44H,4,15-16,18,20,22H2,1-3H3 |
| InChIKey | HNBJPELLNWCSGF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|