C14H27ClN2 — CID 16743724
(1E,3E)-5-butylimino-N,N-diethyl-4-methylpenta-1,3-dien-1-amine;hydrochloride (PubChem CID 16743724) has the molecular formula C14H27ClN2 and a molecular weight of 258.84 g/mol. Its IUPAC name is (1E,3E)-5-butylimino-N,N-diethyl-4-methylpenta-1,3-dien-1-amine;hydrochloride.
| Compound Name | (1E,3E)-5-butylimino-N,N-diethyl-4-methylpenta-1,3-dien-1-amine;hydrochloride |
|---|---|
| PubChem CID | 16743724 |
| Molecular Formula | C14H27ClN2 |
| Molecular Weight | 258.84 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (1E,3E)-5-butylimino-N,N-diethyl-4-methylpenta-1,3-dien-1-amine;hydrochloride |
| SMILES | CCCC/N=C/C(C)=C/C=C/N(CC)CC.Cl |
| InChI | InChI=1S/C14H26N2.ClH/c1-5-8-11-15-13-14(4)10-9-12-16(6-2)7-3;/h9-10,12-13H,5-8,11H2,1-4H3;1H/b12-9+,14-10+,15-13+; |
| InChIKey | JRRNZLRYVJZLPT-CGSMAHNDSA-N |
| XLogP | 4.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|