About 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol
6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 167438268) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 167438268 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC=C1C=C(C(C)(C)CC)C=C(C(C)(C)CC)C1O |
| InChI | InChI=1S/C18H30O/c1-8-13-11-14(17(4,5)9-2)12-15(16(13)19)18(6,7)10-3/h8,11-12,16,19H,9-10H2,1-7H3 |
| InChIKey | PKZHHVQGUOCWCS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol (CID 167438268) is 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol is CC=C1C=C(C(C)(C)CC)C=C(C(C)(C)CC)C1O.
What is the InChIKey of 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol?
The InChIKey is PKZHHVQGUOCWCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-8-13-11-14(17(4,5)9-2)12-15(16(13)19)18(6,7)10-3/h8,11-12,16,19H,9-10H2,1-7H3.
What are the key properties of 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol?
6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol has a molecular weight of 262.44 g/mol, XLogP of 5.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylidene-2,4-bis(2-methylbutan-2-yl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 167438268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).