C24H23F2N7O3S — CID 167438372
2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]-3,5-difluorophenyl]methyl]guanidine (PubChem CID 167438372) has the molecular formula C24H23F2N7O3S and a molecular weight of 527.56 g/mol. Its IUPAC name is 2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]-3,5-difluorophenyl]methyl]guanidine.
| Compound Name | 2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]-3,5-difluorophenyl]methyl]guanidine |
|---|---|
| PubChem CID | 167438372 |
| Molecular Formula | C24H23F2N7O3S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 2-[[4-[5-[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]-1,2-oxazol-3-yl]-3,5-difluorophenyl]methyl]guanidine |
| SMILES | CC(C)S(=O)(=O)c1ccc(-c2cnc(N)c(-c3cc(-c4c(F)cc(CN=C(N)N)cc4F)no3)n2)cc1 |
| InChI | InChI=1S/C24H23F2N7O3S/c1-12(2)37(34,35)15-5-3-14(4-6-15)19-11-30-23(27)22(32-19)20-9-18(33-36-20)21-16(25)7-13(8-17(21)26)10-31-24(28)29/h3-9,11-12H,10H2,1-2H3,(H2,27,30)(H4,28,29,31) |
| InChIKey | DRIVPABHOPARDV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 176.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|