C23H25F2N7O2 — CID 167438776
7-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-2,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-1-one (PubChem CID 167438776) has the molecular formula C23H25F2N7O2 and a molecular weight of 469.50 g/mol. Its IUPAC name is 7-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-2,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-1-one.
| Compound Name | 7-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-2,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 167438776 |
| Molecular Formula | C23H25F2N7O2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 7-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-2,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-1-one |
| SMILES | Cc1nnn(-c2ccc(C(F)F)cc2)c1COc1ccc(N2CCC3CCNC(=O)C3C2)nn1 |
| InChI | InChI=1S/C23H25F2N7O2/c1-14-19(32(30-27-14)17-4-2-16(3-5-17)22(24)25)13-34-21-7-6-20(28-29-21)31-11-9-15-8-10-26-23(33)18(15)12-31/h2-7,15,18,22H,8-13H2,1H3,(H,26,33) |
| InChIKey | DLYGPZGQPYRXPV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |